C26H32N2O3 — CID 123577661
N-[1-[4-[1-[4-(cyclopropylmethoxy)phenyl]azetidin-3-yl]phenyl]ethyl]oxolane-3-carboxamide (PubChem CID 123577661) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is N-[1-[4-[1-[4-(cyclopropylmethoxy)phenyl]azetidin-3-yl]phenyl]ethyl]oxolane-3-carboxamide.
| Compound Name | N-[1-[4-[1-[4-(cyclopropylmethoxy)phenyl]azetidin-3-yl]phenyl]ethyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 123577661 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | N-[1-[4-[1-[4-(cyclopropylmethoxy)phenyl]azetidin-3-yl]phenyl]ethyl]oxolane-3-carboxamide |
| SMILES | CC(NC(=O)C1CCOC1)c1ccc(C2CN(c3ccc(OCC4CC4)cc3)C2)cc1 |
| InChI | InChI=1S/C26H32N2O3/c1-18(27-26(29)22-12-13-30-17-22)20-4-6-21(7-5-20)23-14-28(15-23)24-8-10-25(11-9-24)31-16-19-2-3-19/h4-11,18-19,22-23H,2-3,12-17H2,1H3,(H,27,29) |
| InChIKey | GUDYYVWSLLHNDB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|