C28H37N3O3 — CID 118473422
(3R)-3-amino-N-[(1S)-1-[4-[(3R)-1-[4-(cyclopropylmethoxy)phenyl]pyrrolidin-3-yl]oxyphenyl]ethyl]cyclopentane-1-carboxamide (PubChem CID 118473422) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is (3R)-3-amino-N-[(1S)-1-[4-[(3R)-1-[4-(cyclopropylmethoxy)phenyl]pyrrolidin-3-yl]oxyphenyl]ethyl]cyclopentane-1-carboxamide.
| Compound Name | (3R)-3-amino-N-[(1S)-1-[4-[(3R)-1-[4-(cyclopropylmethoxy)phenyl]pyrrolidin-3-yl]oxyphenyl]ethyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 118473422 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | (3R)-3-amino-N-[(1S)-1-[4-[(3R)-1-[4-(cyclopropylmethoxy)phenyl]pyrrolidin-3-yl]oxyphenyl]ethyl]cyclopentane-1-carboxamide |
| SMILES | C[C@H](NC(=O)C1CC[C@@H](N)C1)c1ccc(O[C@@H]2CCN(c3ccc(OCC4CC4)cc3)C2)cc1 |
| InChI | InChI=1S/C28H37N3O3/c1-19(30-28(32)22-4-7-23(29)16-22)21-5-10-26(11-6-21)34-27-14-15-31(17-27)24-8-12-25(13-9-24)33-18-20-2-3-20/h5-6,8-13,19-20,22-23,27H,2-4,7,14-18,29H2,1H3,(H,30,32)/t19-,22?,23+,27+/m0/s1 |
| InChIKey | KSYLJFSCSLWKNN-KSXGGFLYSA-N |
| XLogP | 4.44 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|