C29H35N5O3 — CID 118473253
3-[(1S)-1-[4-[1-[4-(cyclopropylmethoxy)phenyl]pyrrolidin-3-yl]oxyphenyl]ethyl]-1-methyl-1-(pyrimidin-4-ylmethyl)urea (PubChem CID 118473253) has the molecular formula C29H35N5O3 and a molecular weight of 501.63 g/mol. Its IUPAC name is 3-[(1S)-1-[4-[1-[4-(cyclopropylmethoxy)phenyl]pyrrolidin-3-yl]oxyphenyl]ethyl]-1-methyl-1-(pyrimidin-4-ylmethyl)urea.
| Compound Name | 3-[(1S)-1-[4-[1-[4-(cyclopropylmethoxy)phenyl]pyrrolidin-3-yl]oxyphenyl]ethyl]-1-methyl-1-(pyrimidin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 118473253 |
| Molecular Formula | C29H35N5O3 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | 3-[(1S)-1-[4-[1-[4-(cyclopropylmethoxy)phenyl]pyrrolidin-3-yl]oxyphenyl]ethyl]-1-methyl-1-(pyrimidin-4-ylmethyl)urea |
| SMILES | C[C@H](NC(=O)N(C)Cc1ccncn1)c1ccc(OC2CCN(c3ccc(OCC4CC4)cc3)C2)cc1 |
| InChI | InChI=1S/C29H35N5O3/c1-21(32-29(35)33(2)17-24-13-15-30-20-31-24)23-5-9-27(10-6-23)37-28-14-16-34(18-28)25-7-11-26(12-8-25)36-19-22-3-4-22/h5-13,15,20-22,28H,3-4,14,16-19H2,1-2H3,(H,32,35)/t21-,28?/m0/s1 |
| InChIKey | MJSUPULSYYTNKB-QDLLFRBVSA-N |
| XLogP | 4.83 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|