C27H34N2O3 — CID 123211751
N-[1-[4-[1-[4-(cyclopropylmethoxy)phenyl]azetidin-3-yl]phenyl]ethyl]-3-methoxycyclobutane-1-carboxamide (PubChem CID 123211751) has the molecular formula C27H34N2O3 and a molecular weight of 434.58 g/mol. Its IUPAC name is N-[1-[4-[1-[4-(cyclopropylmethoxy)phenyl]azetidin-3-yl]phenyl]ethyl]-3-methoxycyclobutane-1-carboxamide.
| Compound Name | N-[1-[4-[1-[4-(cyclopropylmethoxy)phenyl]azetidin-3-yl]phenyl]ethyl]-3-methoxycyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 123211751 |
| Molecular Formula | C27H34N2O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | N-[1-[4-[1-[4-(cyclopropylmethoxy)phenyl]azetidin-3-yl]phenyl]ethyl]-3-methoxycyclobutane-1-carboxamide |
| SMILES | COC1CC(C(=O)NC(C)c2ccc(C3CN(c4ccc(OCC5CC5)cc4)C3)cc2)C1 |
| InChI | InChI=1S/C27H34N2O3/c1-18(28-27(30)22-13-26(14-22)31-2)20-5-7-21(8-6-20)23-15-29(16-23)24-9-11-25(12-10-24)32-17-19-3-4-19/h5-12,18-19,22-23,26H,3-4,13-17H2,1-2H3,(H,28,30) |
| InChIKey | IZUPEZHDSJHALM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|