About 3-[(1S)-1-[4-[1-(6-chloropyrimidin-4-yl)piperidin-4-yl]phenyl]ethyl]-1,1-dimethylurea
3-[(1S)-1-[4-[1-(6-chloropyrimidin-4-yl)piperidin-4-yl]phenyl]ethyl]-1,1-dimethylurea (PubChem CID 88536559) has the molecular formula C20H26ClN5O
and a molecular weight of 387.92 g/mol. Its IUPAC name is 3-[(1S)-1-[4-[1-(6-chloropyrimidin-4-yl)piperidin-4-yl]phenyl]ethyl]-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-[(1S)-1-[4-[1-(6-chloropyrimidin-4-yl)piperidin-4-yl]phenyl]ethyl]-1,1-dimethylurea |
| PubChem CID | 88536559 |
| Molecular Formula | C20H26ClN5O |
| Molecular Weight | 387.92 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 3-[(1S)-1-[4-[1-(6-chloropyrimidin-4-yl)piperidin-4-yl]phenyl]ethyl]-1,1-dimethylurea |
| SMILES | C[C@H](NC(=O)N(C)C)c1ccc(C2CCN(c3cc(Cl)ncn3)CC2)cc1 |
| InChI | InChI=1S/C20H26ClN5O/c1-14(24-20(27)25(2)3)15-4-6-16(7-5-15)17-8-10-26(11-9-17)19-12-18(21)22-13-23-19/h4-7,12-14,17H,8-11H2,1-3H3,(H,24,27)/t14-/m0/s1 |
| InChIKey | BMQMUINCILQOHS-AWEZNQCLSA-N |
| XLogP | 3.85 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.92 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(1S)-1-[4-[1-(6-chloropyrimidin-4-yl)piperidin-4-yl]phenyl]ethyl]-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S)-1-[4-[1-(6-chloropyrimidin-4-yl)piperidin-4-yl]phenyl]ethyl]-1,1-dimethylurea?
The IUPAC name of 3-[(1S)-1-[4-[1-(6-chloropyrimidin-4-yl)piperidin-4-yl]phenyl]ethyl]-1,1-dimethylurea (CID 88536559) is 3-[(1S)-1-[4-[1-(6-chloropyrimidin-4-yl)piperidin-4-yl]phenyl]ethyl]-1,1-dimethylurea.
What is the SMILES notation for 3-[(1S)-1-[4-[1-(6-chloropyrimidin-4-yl)piperidin-4-yl]phenyl]ethyl]-1,1-dimethylurea?
The canonical SMILES for 3-[(1S)-1-[4-[1-(6-chloropyrimidin-4-yl)piperidin-4-yl]phenyl]ethyl]-1,1-dimethylurea is C[C@H](NC(=O)N(C)C)c1ccc(C2CCN(c3cc(Cl)ncn3)CC2)cc1.
What is the InChIKey of 3-[(1S)-1-[4-[1-(6-chloropyrimidin-4-yl)piperidin-4-yl]phenyl]ethyl]-1,1-dimethylurea?
The InChIKey is BMQMUINCILQOHS-AWEZNQCLSA-N. The full InChI is InChI=1S/C20H26ClN5O/c1-14(24-20(27)25(2)3)15-4-6-16(7-5-15)17-8-10-26(11-9-17)19-12-18(21)22-13-23-19/h4-7,12-14,17H,8-11H2,1-3H3,(H,24,27)/t14-/m0/s1.
What are the key properties of 3-[(1S)-1-[4-[1-(6-chloropyrimidin-4-yl)piperidin-4-yl]phenyl]ethyl]-1,1-dimethylurea?
3-[(1S)-1-[4-[1-(6-chloropyrimidin-4-yl)piperidin-4-yl]phenyl]ethyl]-1,1-dimethylurea has a molecular weight of 387.92 g/mol, XLogP of 3.85, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S)-1-[4-[1-(6-chloropyrimidin-4-yl)piperidin-4-yl]phenyl]ethyl]-1,1-dimethylurea is sourced from PubChem (CID 88536559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).