C22H26ClNO2 — CID 159075656
2-[4-[(3R)-1-(3-chlorophenyl)pyrrolidin-3-yl]oxyphenyl]hexan-3-one (PubChem CID 159075656) has the molecular formula C22H26ClNO2 and a molecular weight of 371.91 g/mol. Its IUPAC name is 2-[4-[(3R)-1-(3-chlorophenyl)pyrrolidin-3-yl]oxyphenyl]hexan-3-one.
| Compound Name | 2-[4-[(3R)-1-(3-chlorophenyl)pyrrolidin-3-yl]oxyphenyl]hexan-3-one |
|---|---|
| PubChem CID | 159075656 |
| Molecular Formula | C22H26ClNO2 |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 2-[4-[(3R)-1-(3-chlorophenyl)pyrrolidin-3-yl]oxyphenyl]hexan-3-one |
| SMILES | CCCC(=O)C(C)c1ccc(O[C@@H]2CCN(c3cccc(Cl)c3)C2)cc1 |
| InChI | InChI=1S/C22H26ClNO2/c1-3-5-22(25)16(2)17-8-10-20(11-9-17)26-21-12-13-24(15-21)19-7-4-6-18(23)14-19/h4,6-11,14,16,21H,3,5,12-13,15H2,1-2H3/t16?,21-/m1/s1 |
| InChIKey | KAFDZDRSHOIJAQ-CAWMZFRYSA-N |
| XLogP | 5.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |