C22H25F2NO2 — CID 158548981
(4R)-4-[4-[1-[3-(difluoromethyl)phenyl]pyrrolidin-3-yl]oxyphenyl]pentan-2-one (PubChem CID 158548981) has the molecular formula C22H25F2NO2 and a molecular weight of 373.44 g/mol. Its IUPAC name is (4R)-4-[4-[1-[3-(difluoromethyl)phenyl]pyrrolidin-3-yl]oxyphenyl]pentan-2-one.
| Compound Name | (4R)-4-[4-[1-[3-(difluoromethyl)phenyl]pyrrolidin-3-yl]oxyphenyl]pentan-2-one |
|---|---|
| PubChem CID | 158548981 |
| Molecular Formula | C22H25F2NO2 |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | (4R)-4-[4-[1-[3-(difluoromethyl)phenyl]pyrrolidin-3-yl]oxyphenyl]pentan-2-one |
| SMILES | CC(=O)C[C@@H](C)c1ccc(OC2CCN(c3cccc(C(F)F)c3)C2)cc1 |
| InChI | InChI=1S/C22H25F2NO2/c1-15(12-16(2)26)17-6-8-20(9-7-17)27-21-10-11-25(14-21)19-5-3-4-18(13-19)22(23)24/h3-9,13,15,21-22H,10-12,14H2,1-2H3/t15-,21?/m1/s1 |
| InChIKey | HPMBWPDBDCYGHN-RBFZIWAESA-N |
| XLogP | 5.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |