C24H30FNO4 — CID 153169982
(4R)-4-[4-[1-[2-fluoro-4-(2-methoxyethoxy)phenyl]pyrrolidin-3-yl]oxyphenyl]pentan-2-one (PubChem CID 153169982) has the molecular formula C24H30FNO4 and a molecular weight of 415.51 g/mol. Its IUPAC name is (4R)-4-[4-[1-[2-fluoro-4-(2-methoxyethoxy)phenyl]pyrrolidin-3-yl]oxyphenyl]pentan-2-one.
| Compound Name | (4R)-4-[4-[1-[2-fluoro-4-(2-methoxyethoxy)phenyl]pyrrolidin-3-yl]oxyphenyl]pentan-2-one |
|---|---|
| PubChem CID | 153169982 |
| Molecular Formula | C24H30FNO4 |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | (4R)-4-[4-[1-[2-fluoro-4-(2-methoxyethoxy)phenyl]pyrrolidin-3-yl]oxyphenyl]pentan-2-one |
| SMILES | COCCOc1ccc(N2CCC(Oc3ccc([C@H](C)CC(C)=O)cc3)C2)c(F)c1 |
| InChI | InChI=1S/C24H30FNO4/c1-17(14-18(2)27)19-4-6-20(7-5-19)30-22-10-11-26(16-22)24-9-8-21(15-23(24)25)29-13-12-28-3/h4-9,15,17,22H,10-14,16H2,1-3H3/t17-,22?/m1/s1 |
| InChIKey | WEACZAXPKNNJNH-PLEWWHCXSA-N |
| XLogP | 4.59 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|