C23H29N3O3 — CID 140648530
(3S)-3-[4-[(3R)-1-(2-cyclobutyloxy-4-pyridinyl)pyrrolidin-3-yl]oxyphenyl]butanamide (PubChem CID 140648530) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is (3S)-3-[4-[(3R)-1-(2-cyclobutyloxy-4-pyridinyl)pyrrolidin-3-yl]oxyphenyl]butanamide.
| Compound Name | (3S)-3-[4-[(3R)-1-(2-cyclobutyloxy-4-pyridinyl)pyrrolidin-3-yl]oxyphenyl]butanamide |
|---|---|
| PubChem CID | 140648530 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | (3S)-3-[4-[(3R)-1-(2-cyclobutyloxy-4-pyridinyl)pyrrolidin-3-yl]oxyphenyl]butanamide |
| SMILES | C[C@@H](CC(N)=O)c1ccc(O[C@@H]2CCN(c3ccnc(OC4CCC4)c3)C2)cc1 |
| InChI | InChI=1S/C23H29N3O3/c1-16(13-22(24)27)17-5-7-20(8-6-17)28-21-10-12-26(15-21)18-9-11-25-23(14-18)29-19-3-2-4-19/h5-9,11,14,16,19,21H,2-4,10,12-13,15H2,1H3,(H2,24,27)/t16-,21+/m0/s1 |
| InChIKey | GCJVODRDHMBABS-HRAATJIYSA-N |
| XLogP | 3.65 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |