C25H31NO3 — CID 158241695
4-[4-[1-(4-cyclopentyloxyphenyl)azetidin-3-yl]oxyphenyl]pentan-2-one (PubChem CID 158241695) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is 4-[4-[1-(4-cyclopentyloxyphenyl)azetidin-3-yl]oxyphenyl]pentan-2-one.
| Compound Name | 4-[4-[1-(4-cyclopentyloxyphenyl)azetidin-3-yl]oxyphenyl]pentan-2-one |
|---|---|
| PubChem CID | 158241695 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 4-[4-[1-(4-cyclopentyloxyphenyl)azetidin-3-yl]oxyphenyl]pentan-2-one |
| SMILES | CC(=O)CC(C)c1ccc(OC2CN(c3ccc(OC4CCCC4)cc3)C2)cc1 |
| InChI | InChI=1S/C25H31NO3/c1-18(15-19(2)27)20-7-11-23(12-8-20)29-25-16-26(17-25)21-9-13-24(14-10-21)28-22-5-3-4-6-22/h7-14,18,22,25H,3-6,15-17H2,1-2H3 |
| InChIKey | GFPQMTVFAUVQLV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|