C21H24F3N3O2 — CID 148908948
2-[4-[(3R)-1-[2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidin-3-yl]oxyphenyl]hexan-3-one (PubChem CID 148908948) has the molecular formula C21H24F3N3O2 and a molecular weight of 407.44 g/mol. Its IUPAC name is 2-[4-[(3R)-1-[2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidin-3-yl]oxyphenyl]hexan-3-one.
| Compound Name | 2-[4-[(3R)-1-[2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidin-3-yl]oxyphenyl]hexan-3-one |
|---|---|
| PubChem CID | 148908948 |
| Molecular Formula | C21H24F3N3O2 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 2-[4-[(3R)-1-[2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidin-3-yl]oxyphenyl]hexan-3-one |
| SMILES | CCCC(=O)C(C)c1ccc(O[C@@H]2CCN(c3ccnc(C(F)(F)F)n3)C2)cc1 |
| InChI | InChI=1S/C21H24F3N3O2/c1-3-4-18(28)14(2)15-5-7-16(8-6-15)29-17-10-12-27(13-17)19-9-11-25-20(26-19)21(22,23)24/h5-9,11,14,17H,3-4,10,12-13H2,1-2H3/t14?,17-/m1/s1 |
| InChIKey | PIFZUWBYICIZFI-FBMWCMRBSA-N |
| XLogP | 4.63 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |