C26H34N2O2 — CID 71576220
2-[4-[1-(4-cyclobutyloxyphenyl)piperidin-4-yl]phenyl]-N-ethylpropanamide (PubChem CID 71576220) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is 2-[4-[1-(4-cyclobutyloxyphenyl)piperidin-4-yl]phenyl]-N-ethylpropanamide.
| Compound Name | 2-[4-[1-(4-cyclobutyloxyphenyl)piperidin-4-yl]phenyl]-N-ethylpropanamide |
|---|---|
| PubChem CID | 71576220 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 2-[4-[1-(4-cyclobutyloxyphenyl)piperidin-4-yl]phenyl]-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)c1ccc(C2CCN(c3ccc(OC4CCC4)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H34N2O2/c1-3-27-26(29)19(2)20-7-9-21(10-8-20)22-15-17-28(18-16-22)23-11-13-25(14-12-23)30-24-5-4-6-24/h7-14,19,22,24H,3-6,15-18H2,1-2H3,(H,27,29) |
| InChIKey | IKBCVXBZNDAPRQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|