C37H41N7O3 — CID 177002980
3-[4-[1-[1-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]phenyl]piperidin-4-yl]piperidin-4-yl]anilino]piperidine-2,6-dione (PubChem CID 177002980) has the molecular formula C37H41N7O3 and a molecular weight of 631.78 g/mol. Its IUPAC name is 3-[4-[1-[1-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]phenyl]piperidin-4-yl]piperidin-4-yl]anilino]piperidine-2,6-dione.
| Compound Name | 3-[4-[1-[1-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]phenyl]piperidin-4-yl]piperidin-4-yl]anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177002980 |
| Molecular Formula | C37H41N7O3 |
| Molecular Weight | 631.78 g/mol |
| Exact Mass | 631.33 |
| IUPAC Name | 3-[4-[1-[1-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]phenyl]piperidin-4-yl]piperidin-4-yl]anilino]piperidine-2,6-dione |
| SMILES | Nc1nnc(-c2ccccc2O)cc1-c1ccc(N2CCC(N3CCC(c4ccc(NC5CCC(=O)NC5=O)cc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C37H41N7O3/c38-36-31(23-33(41-42-36)30-3-1-2-4-34(30)45)26-7-11-28(12-8-26)44-21-17-29(18-22-44)43-19-15-25(16-20-43)24-5-9-27(10-6-24)39-32-13-14-35(46)40-37(32)47/h1-12,23,25,29,32,39,45H,13-22H2,(H2,38,42)(H,40,46,47) |
| InChIKey | IMFFUXVLQNVPPA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.78 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|