C27H34N4O3 — CID 177363602
3-[4-[1-[1-(4-aminophenyl)piperidin-4-yl]piperidin-4-yl]phenoxy]piperidine-2,6-dione (PubChem CID 177363602) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is 3-[4-[1-[1-(4-aminophenyl)piperidin-4-yl]piperidin-4-yl]phenoxy]piperidine-2,6-dione.
| Compound Name | 3-[4-[1-[1-(4-aminophenyl)piperidin-4-yl]piperidin-4-yl]phenoxy]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177363602 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 3-[4-[1-[1-(4-aminophenyl)piperidin-4-yl]piperidin-4-yl]phenoxy]piperidine-2,6-dione |
| SMILES | Nc1ccc(N2CCC(N3CCC(c4ccc(OC5CCC(=O)NC5=O)cc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C27H34N4O3/c28-21-3-5-22(6-4-21)31-17-13-23(14-18-31)30-15-11-20(12-16-30)19-1-7-24(8-2-19)34-25-9-10-26(32)29-27(25)33/h1-8,20,23,25H,9-18,28H2,(H,29,32,33) |
| InChIKey | WYUGNKOJGMEOTH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|