C16H19N3O5 — CID 156506164
4-[4-(2,6-dioxopiperidin-3-yl)oxyphenyl]piperazine-1-carboxylic acid (PubChem CID 156506164) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is 4-[4-(2,6-dioxopiperidin-3-yl)oxyphenyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[4-(2,6-dioxopiperidin-3-yl)oxyphenyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 156506164 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 4-[4-(2,6-dioxopiperidin-3-yl)oxyphenyl]piperazine-1-carboxylic acid |
| SMILES | O=C1CCC(Oc2ccc(N3CCN(C(=O)O)CC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C16H19N3O5/c20-14-6-5-13(15(21)17-14)24-12-3-1-11(2-4-12)18-7-9-19(10-8-18)16(22)23/h1-4,13H,5-10H2,(H,22,23)(H,17,20,21) |
| InChIKey | RQVBJYSHPBGTOZ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|