C33H42N4O4 — CID 170979389
3-[4-[3-[4-[(E)-1-(dimethylamino)but-1-en-2-yl]benzoyl]-3,9-diazaspiro[5.5]undecan-9-yl]phenoxy]piperidine-2,6-dione (PubChem CID 170979389) has the molecular formula C33H42N4O4 and a molecular weight of 558.72 g/mol. Its IUPAC name is 3-[4-[3-[4-[(E)-1-(dimethylamino)but-1-en-2-yl]benzoyl]-3,9-diazaspiro[5.5]undecan-9-yl]phenoxy]piperidine-2,6-dione.
| Compound Name | 3-[4-[3-[4-[(E)-1-(dimethylamino)but-1-en-2-yl]benzoyl]-3,9-diazaspiro[5.5]undecan-9-yl]phenoxy]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170979389 |
| Molecular Formula | C33H42N4O4 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | 3-[4-[3-[4-[(E)-1-(dimethylamino)but-1-en-2-yl]benzoyl]-3,9-diazaspiro[5.5]undecan-9-yl]phenoxy]piperidine-2,6-dione |
| SMILES | CC/C(=C\N(C)C)c1ccc(C(=O)N2CCC3(CC2)CCN(c2ccc(OC4CCC(=O)NC4=O)cc2)CC3)cc1 |
| InChI | InChI=1S/C33H42N4O4/c1-4-24(23-35(2)3)25-5-7-26(8-6-25)32(40)37-21-17-33(18-22-37)15-19-36(20-16-33)27-9-11-28(12-10-27)41-29-13-14-30(38)34-31(29)39/h5-12,23,29H,4,13-22H2,1-3H3,(H,34,38,39)/b24-23+ |
| InChIKey | GCMQVYKYTDUDJD-WCWDXBQESA-N |
| XLogP | 4.71 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|