About 3-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenoxy]piperidine-2,6-dione
3-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenoxy]piperidine-2,6-dione (PubChem CID 172616793) has the molecular formula C18H22N2O5
and a molecular weight of 346.38 g/mol. Its IUPAC name is 3-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenoxy]piperidine-2,6-dione.
Molecular Properties
| Compound Name | 3-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenoxy]piperidine-2,6-dione |
| PubChem CID | 172616793 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 3-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenoxy]piperidine-2,6-dione |
| SMILES | O=C1CCC(Oc2ccc(N3CCC4(CC3)OCCO4)cc2)C(=O)N1 |
| InChI | InChI=1S/C18H22N2O5/c21-16-6-5-15(17(22)19-16)25-14-3-1-13(2-4-14)20-9-7-18(8-10-20)23-11-12-24-18/h1-4,15H,5-12H2,(H,19,21,22) |
| InChIKey | NRISIHYSNBGFGO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenoxy]piperidine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenoxy]piperidine-2,6-dione?
The IUPAC name of 3-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenoxy]piperidine-2,6-dione (CID 172616793) is 3-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenoxy]piperidine-2,6-dione.
What is the SMILES notation for 3-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenoxy]piperidine-2,6-dione?
The canonical SMILES for 3-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenoxy]piperidine-2,6-dione is O=C1CCC(Oc2ccc(N3CCC4(CC3)OCCO4)cc2)C(=O)N1.
What is the InChIKey of 3-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenoxy]piperidine-2,6-dione?
The InChIKey is NRISIHYSNBGFGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O5/c21-16-6-5-15(17(22)19-16)25-14-3-1-13(2-4-14)20-9-7-18(8-10-20)23-11-12-24-18/h1-4,15H,5-12H2,(H,19,21,22).
What are the key properties of 3-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenoxy]piperidine-2,6-dione?
3-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenoxy]piperidine-2,6-dione has a molecular weight of 346.38 g/mol, XLogP of 1.21, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenoxy]piperidine-2,6-dione is sourced from PubChem (CID 172616793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).