C18H23N3O3 — CID 162725566
3-[4-[1-(1-aminoethenyl)piperidin-4-yl]phenoxy]piperidine-2,6-dione (PubChem CID 162725566) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-[4-[1-(1-aminoethenyl)piperidin-4-yl]phenoxy]piperidine-2,6-dione.
| Compound Name | 3-[4-[1-(1-aminoethenyl)piperidin-4-yl]phenoxy]piperidine-2,6-dione |
|---|---|
| PubChem CID | 162725566 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 3-[4-[1-(1-aminoethenyl)piperidin-4-yl]phenoxy]piperidine-2,6-dione |
| SMILES | C=C(N)N1CCC(c2ccc(OC3CCC(=O)NC3=O)cc2)CC1 |
| InChI | InChI=1S/C18H23N3O3/c1-12(19)21-10-8-14(9-11-21)13-2-4-15(5-3-13)24-16-6-7-17(22)20-18(16)23/h2-5,14,16H,1,6-11,19H2,(H,20,22,23) |
| InChIKey | NJBIZFAZBBCIPF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|