C22H28F3N3O6 — CID 175284130
4-[4-[4-(2,6-dioxopiperidin-3-yl)oxyphenyl]piperidin-1-yl]butanamide;2,2,2-trifluoroacetic acid (PubChem CID 175284130) has the molecular formula C22H28F3N3O6 and a molecular weight of 487.48 g/mol. Its IUPAC name is 4-[4-[4-(2,6-dioxopiperidin-3-yl)oxyphenyl]piperidin-1-yl]butanamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[4-[4-(2,6-dioxopiperidin-3-yl)oxyphenyl]piperidin-1-yl]butanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175284130 |
| Molecular Formula | C22H28F3N3O6 |
| Molecular Weight | 487.48 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 4-[4-[4-(2,6-dioxopiperidin-3-yl)oxyphenyl]piperidin-1-yl]butanamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)CCCN1CCC(c2ccc(OC3CCC(=O)NC3=O)cc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H27N3O4.C2HF3O2/c21-18(24)2-1-11-23-12-9-15(10-13-23)14-3-5-16(6-4-14)27-17-7-8-19(25)22-20(17)26;3-2(4,5)1(6)7/h3-6,15,17H,1-2,7-13H2,(H2,21,24)(H,22,25,26);(H,6,7) |
| InChIKey | CRFWYJUDHMFNNX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 139.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|