C28H34N4O5 — CID 177363541
3-[4-[1-[[1-(4-nitrophenyl)piperidin-4-yl]methyl]piperidin-4-yl]phenoxy]piperidine-2,6-dione (PubChem CID 177363541) has the molecular formula C28H34N4O5 and a molecular weight of 506.60 g/mol. Its IUPAC name is 3-[4-[1-[[1-(4-nitrophenyl)piperidin-4-yl]methyl]piperidin-4-yl]phenoxy]piperidine-2,6-dione.
| Compound Name | 3-[4-[1-[[1-(4-nitrophenyl)piperidin-4-yl]methyl]piperidin-4-yl]phenoxy]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177363541 |
| Molecular Formula | C28H34N4O5 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | 3-[4-[1-[[1-(4-nitrophenyl)piperidin-4-yl]methyl]piperidin-4-yl]phenoxy]piperidine-2,6-dione |
| SMILES | O=C1CCC(Oc2ccc(C3CCN(CC4CCN(c5ccc([N+](=O)[O-])cc5)CC4)CC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C28H34N4O5/c33-27-10-9-26(28(34)29-27)37-25-7-1-21(2-8-25)22-13-15-30(16-14-22)19-20-11-17-31(18-12-20)23-3-5-24(6-4-23)32(35)36/h1-8,20,22,26H,9-19H2,(H,29,33,34) |
| InChIKey | KCFZNQQHQAYCAP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|