C18H24N4O3 — CID 177362134
3-[4-(3-piperazin-1-ylazetidin-1-yl)phenoxy]piperidine-2,6-dione (PubChem CID 177362134) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 3-[4-(3-piperazin-1-ylazetidin-1-yl)phenoxy]piperidine-2,6-dione.
| Compound Name | 3-[4-(3-piperazin-1-ylazetidin-1-yl)phenoxy]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177362134 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 3-[4-(3-piperazin-1-ylazetidin-1-yl)phenoxy]piperidine-2,6-dione |
| SMILES | O=C1CCC(Oc2ccc(N3CC(N4CCNCC4)C3)cc2)C(=O)N1 |
| InChI | InChI=1S/C18H24N4O3/c23-17-6-5-16(18(24)20-17)25-15-3-1-13(2-4-15)22-11-14(12-22)21-9-7-19-8-10-21/h1-4,14,16,19H,5-12H2,(H,20,23,24) |
| InChIKey | QQWXYVVNAYVROF-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|