C20H26N2O5 — CID 159240821
4-[4-[4-(2,6-dioxopiperidin-3-yl)oxyphenyl]piperidin-1-yl]butanoic acid (PubChem CID 159240821) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is 4-[4-[4-(2,6-dioxopiperidin-3-yl)oxyphenyl]piperidin-1-yl]butanoic acid.
| Compound Name | 4-[4-[4-(2,6-dioxopiperidin-3-yl)oxyphenyl]piperidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 159240821 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 4-[4-[4-(2,6-dioxopiperidin-3-yl)oxyphenyl]piperidin-1-yl]butanoic acid |
| SMILES | O=C(O)CCCN1CCC(c2ccc(OC3CCC(=O)NC3=O)cc2)CC1 |
| InChI | InChI=1S/C20H26N2O5/c23-18-8-7-17(20(26)21-18)27-16-5-3-14(4-6-16)15-9-12-22(13-10-15)11-1-2-19(24)25/h3-6,15,17H,1-2,7-13H2,(H,24,25)(H,21,23,26) |
| InChIKey | KUBMFLKTKGDYLZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|