C28H39N3O3 — CID 172823692
3-[4-[9-(piperidin-4-ylmethyl)-3-azaspiro[5.5]undecane-3-carbonyl]phenyl]piperidine-2,6-dione (PubChem CID 172823692) has the molecular formula C28H39N3O3 and a molecular weight of 465.64 g/mol. Its IUPAC name is 3-[4-[9-(piperidin-4-ylmethyl)-3-azaspiro[5.5]undecane-3-carbonyl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[9-(piperidin-4-ylmethyl)-3-azaspiro[5.5]undecane-3-carbonyl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 172823692 |
| Molecular Formula | C28H39N3O3 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | 3-[4-[9-(piperidin-4-ylmethyl)-3-azaspiro[5.5]undecane-3-carbonyl]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2ccc(C(=O)N3CCC4(CCC(CC5CCNCC5)CC4)CC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C28H39N3O3/c32-25-6-5-24(26(33)30-25)22-1-3-23(4-2-22)27(34)31-17-13-28(14-18-31)11-7-20(8-12-28)19-21-9-15-29-16-10-21/h1-4,20-21,24,29H,5-19H2,(H,30,32,33) |
| InChIKey | UOKUYUBIYJYPEW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|