C23H31N3O3 — CID 172604718
3-[3-[4-(piperidin-4-ylmethyl)piperidine-1-carbonyl]phenyl]piperidine-2,6-dione (PubChem CID 172604718) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 3-[3-[4-(piperidin-4-ylmethyl)piperidine-1-carbonyl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[3-[4-(piperidin-4-ylmethyl)piperidine-1-carbonyl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 172604718 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 3-[3-[4-(piperidin-4-ylmethyl)piperidine-1-carbonyl]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2cccc(C(=O)N3CCC(CC4CCNCC4)CC3)c2)C(=O)N1 |
| InChI | InChI=1S/C23H31N3O3/c27-21-5-4-20(22(28)25-21)18-2-1-3-19(15-18)23(29)26-12-8-17(9-13-26)14-16-6-10-24-11-7-16/h1-3,15-17,20,24H,4-14H2,(H,25,27,28) |
| InChIKey | NXMCOAOCYHVVOS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|