C21H27N3O4 — CID 175555265
4-[[6-(2,6-dioxopiperidin-3-yl)-3,4-dihydro-1H-isoquinolin-2-yl]methyl]piperidine-1-carboxylic acid (PubChem CID 175555265) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 4-[[6-(2,6-dioxopiperidin-3-yl)-3,4-dihydro-1H-isoquinolin-2-yl]methyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[[6-(2,6-dioxopiperidin-3-yl)-3,4-dihydro-1H-isoquinolin-2-yl]methyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175555265 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 4-[[6-(2,6-dioxopiperidin-3-yl)-3,4-dihydro-1H-isoquinolin-2-yl]methyl]piperidine-1-carboxylic acid |
| SMILES | O=C1CCC(c2ccc3c(c2)CCN(CC2CCN(C(=O)O)CC2)C3)C(=O)N1 |
| InChI | InChI=1S/C21H27N3O4/c25-19-4-3-18(20(26)22-19)16-1-2-17-13-23(8-7-15(17)11-16)12-14-5-9-24(10-6-14)21(27)28/h1-2,11,14,18H,3-10,12-13H2,(H,27,28)(H,22,25,26) |
| InChIKey | QDQPLXLVNAJNOR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|