C19H17ClN2O4S — CID 177339735
3-[2-(2-chlorophenyl)sulfonyl-1,3-dihydroisoindol-5-yl]piperidine-2,6-dione (PubChem CID 177339735) has the molecular formula C19H17ClN2O4S and a molecular weight of 404.88 g/mol. Its IUPAC name is 3-[2-(2-chlorophenyl)sulfonyl-1,3-dihydroisoindol-5-yl]piperidine-2,6-dione.
| Compound Name | 3-[2-(2-chlorophenyl)sulfonyl-1,3-dihydroisoindol-5-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177339735 |
| Molecular Formula | C19H17ClN2O4S |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 3-[2-(2-chlorophenyl)sulfonyl-1,3-dihydroisoindol-5-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2ccc3c(c2)CN(S(=O)(=O)c2ccccc2Cl)C3)C(=O)N1 |
| InChI | InChI=1S/C19H17ClN2O4S/c20-16-3-1-2-4-17(16)27(25,26)22-10-13-6-5-12(9-14(13)11-22)15-7-8-18(23)21-19(15)24/h1-6,9,15H,7-8,10-11H2,(H,21,23,24) |
| InChIKey | VENOVTUNGNGQGD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|