C19H16N4O5S — CID 177339778
3-[2-(2,1,3-benzoxadiazol-4-ylsulfonyl)-1,3-dihydroisoindol-5-yl]piperidine-2,6-dione (PubChem CID 177339778) has the molecular formula C19H16N4O5S and a molecular weight of 412.43 g/mol. Its IUPAC name is 3-[2-(2,1,3-benzoxadiazol-4-ylsulfonyl)-1,3-dihydroisoindol-5-yl]piperidine-2,6-dione.
| Compound Name | 3-[2-(2,1,3-benzoxadiazol-4-ylsulfonyl)-1,3-dihydroisoindol-5-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177339778 |
| Molecular Formula | C19H16N4O5S |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 3-[2-(2,1,3-benzoxadiazol-4-ylsulfonyl)-1,3-dihydroisoindol-5-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2ccc3c(c2)CN(S(=O)(=O)c2cccc4nonc24)C3)C(=O)N1 |
| InChI | InChI=1S/C19H16N4O5S/c24-17-7-6-14(19(25)20-17)11-4-5-12-9-23(10-13(12)8-11)29(26,27)16-3-1-2-15-18(16)22-28-21-15/h1-5,8,14H,6-7,9-10H2,(H,20,24,25) |
| InChIKey | HCXNISNQZLYMRA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|