C16H15ClN4O5S2 — CID 22772831
4-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]sulfonyl-2,1,3-benzoxadiazole (PubChem CID 22772831) has the molecular formula C16H15ClN4O5S2 and a molecular weight of 442.91 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]sulfonyl-2,1,3-benzoxadiazole.
| Compound Name | 4-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]sulfonyl-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 22772831 |
| Molecular Formula | C16H15ClN4O5S2 |
| Molecular Weight | 442.91 g/mol |
| Exact Mass | 442.02 |
| IUPAC Name | 4-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]sulfonyl-2,1,3-benzoxadiazole |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1CCN(S(=O)(=O)c2cccc3nonc23)CC1 |
| InChI | InChI=1S/C16H15ClN4O5S2/c17-12-4-6-13(7-5-12)27(22,23)20-8-10-21(11-9-20)28(24,25)15-3-1-2-14-16(15)19-26-18-14/h1-7H,8-11H2 |
| InChIKey | JYEZFDGWZBYRKS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 113.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.91 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |