C16H23N4O3S+ — CID 6963599
4-(4-cyclohexylpiperazin-4-ium-1-yl)sulfonyl-2,1,3-benzoxadiazole (PubChem CID 6963599) has the molecular formula C16H23N4O3S+ and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-(4-cyclohexylpiperazin-4-ium-1-yl)sulfonyl-2,1,3-benzoxadiazole.
| Compound Name | 4-(4-cyclohexylpiperazin-4-ium-1-yl)sulfonyl-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 6963599 |
| Molecular Formula | C16H23N4O3S+ |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 4-(4-cyclohexylpiperazin-4-ium-1-yl)sulfonyl-2,1,3-benzoxadiazole |
| SMILES | O=S(=O)(c1cccc2nonc12)N1CC[NH+](C2CCCCC2)CC1 |
| InChI | InChI=1S/C16H22N4O3S/c21-24(22,15-8-4-7-14-16(15)18-23-17-14)20-11-9-19(10-12-20)13-5-2-1-3-6-13/h4,7-8,13H,1-3,5-6,9-12H2/p+1 |
| InChIKey | IPAHAHVEDOOEEF-UHFFFAOYSA-O |
| XLogP | 0.44 |
| TPSA | 80.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |