C20H17F3N2O3S — CID 177339747
3-[2-[2-(trifluoromethoxy)phenyl]sulfanyl-1,3-dihydroisoindol-5-yl]piperidine-2,6-dione (PubChem CID 177339747) has the molecular formula C20H17F3N2O3S and a molecular weight of 422.43 g/mol. Its IUPAC name is 3-[2-[2-(trifluoromethoxy)phenyl]sulfanyl-1,3-dihydroisoindol-5-yl]piperidine-2,6-dione.
| Compound Name | 3-[2-[2-(trifluoromethoxy)phenyl]sulfanyl-1,3-dihydroisoindol-5-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177339747 |
| Molecular Formula | C20H17F3N2O3S |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 3-[2-[2-(trifluoromethoxy)phenyl]sulfanyl-1,3-dihydroisoindol-5-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2ccc3c(c2)CN(Sc2ccccc2OC(F)(F)F)C3)C(=O)N1 |
| InChI | InChI=1S/C20H17F3N2O3S/c21-20(22,23)28-16-3-1-2-4-17(16)29-25-10-13-6-5-12(9-14(13)11-25)15-7-8-18(26)24-19(15)27/h1-6,9,15H,7-8,10-11H2,(H,24,26,27) |
| InChIKey | IEDNIUQOKNRKIR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|