C20H14F3N3O8S — CID 172602502
[6-amino-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl] 2-(trifluoromethoxy)benzenesulfonate (PubChem CID 172602502) has the molecular formula C20H14F3N3O8S and a molecular weight of 513.41 g/mol. Its IUPAC name is [6-amino-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl] 2-(trifluoromethoxy)benzenesulfonate.
| Compound Name | [6-amino-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl] 2-(trifluoromethoxy)benzenesulfonate |
|---|---|
| PubChem CID | 172602502 |
| Molecular Formula | C20H14F3N3O8S |
| Molecular Weight | 513.41 g/mol |
| Exact Mass | 513.05 |
| IUPAC Name | [6-amino-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl] 2-(trifluoromethoxy)benzenesulfonate |
| SMILES | Nc1cc2c(cc1OS(=O)(=O)c1ccccc1OC(F)(F)F)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C20H14F3N3O8S/c21-20(22,23)33-13-3-1-2-4-15(13)35(31,32)34-14-8-10-9(7-11(14)24)18(29)26(19(10)30)12-5-6-16(27)25-17(12)28/h1-4,7-8,12H,5-6,24H2,(H,25,27,28) |
| InChIKey | MBUBMSJXBHZKSQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 162.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|