C24H25N3O2S — CID 177339753
3-[2-[4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]sulfanyl-1,3-dihydroisoindol-5-yl]piperidine-2,6-dione (PubChem CID 177339753) has the molecular formula C24H25N3O2S and a molecular weight of 419.55 g/mol. Its IUPAC name is 3-[2-[4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]sulfanyl-1,3-dihydroisoindol-5-yl]piperidine-2,6-dione.
| Compound Name | 3-[2-[4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]sulfanyl-1,3-dihydroisoindol-5-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177339753 |
| Molecular Formula | C24H25N3O2S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 3-[2-[4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]sulfanyl-1,3-dihydroisoindol-5-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2ccc3c(c2)CN(Sc2ccc(C4=CCNCC4)cc2)C3)C(=O)N1 |
| InChI | InChI=1S/C24H25N3O2S/c28-23-8-7-22(24(29)26-23)18-1-2-19-14-27(15-20(19)13-18)30-21-5-3-16(4-6-21)17-9-11-25-12-10-17/h1-6,9,13,22,25H,7-8,10-12,14-15H2,(H,26,28,29) |
| InChIKey | JZCSGZVTKOUFGZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|