C38H39N7O3 — CID 177338923
3-[4-[4-[4-[5-[3-(2-hydroxyphenyl)pyrrolo[3,2-c]pyridazin-5-yl]-2-pyridinyl]piperidin-1-yl]piperidin-1-yl]phenyl]piperidine-2,6-dione (PubChem CID 177338923) has the molecular formula C38H39N7O3 and a molecular weight of 641.78 g/mol. Its IUPAC name is 3-[4-[4-[4-[5-[3-(2-hydroxyphenyl)pyrrolo[3,2-c]pyridazin-5-yl]-2-pyridinyl]piperidin-1-yl]piperidin-1-yl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[4-[5-[3-(2-hydroxyphenyl)pyrrolo[3,2-c]pyridazin-5-yl]-2-pyridinyl]piperidin-1-yl]piperidin-1-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177338923 |
| Molecular Formula | C38H39N7O3 |
| Molecular Weight | 641.78 g/mol |
| Exact Mass | 641.31 |
| IUPAC Name | 3-[4-[4-[4-[5-[3-(2-hydroxyphenyl)pyrrolo[3,2-c]pyridazin-5-yl]-2-pyridinyl]piperidin-1-yl]piperidin-1-yl]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2ccc(N3CCC(N4CCC(c5ccc(-n6ccc7nnc(-c8ccccc8O)cc76)cn5)CC4)CC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C38H39N7O3/c46-36-4-2-1-3-31(36)34-23-35-33(41-42-34)17-22-45(35)29-9-11-32(39-24-29)26-13-18-43(19-14-26)28-15-20-44(21-16-28)27-7-5-25(6-8-27)30-10-12-37(47)40-38(30)48/h1-9,11,17,22-24,26,28,30,46H,10,12-16,18-21H2,(H,40,47,48) |
| InChIKey | XHEDCSZPSUKGDR-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.78 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|