C40H49N7O4 — CID 172630512
(3R)-3-[4-[4-[[4-[4-cyclopropyl-1-[6-(2-hydroxyphenyl)pyridazin-4-yl]piperidine-4-carbonyl]piperazin-1-yl]methyl]piperidin-1-yl]phenyl]piperidine-2,6-dione (PubChem CID 172630512) has the molecular formula C40H49N7O4 and a molecular weight of 691.88 g/mol. Its IUPAC name is (3R)-3-[4-[4-[[4-[4-cyclopropyl-1-[6-(2-hydroxyphenyl)pyridazin-4-yl]piperidine-4-carbonyl]piperazin-1-yl]methyl]piperidin-1-yl]phenyl]piperidine-2,6-dione.
| Compound Name | (3R)-3-[4-[4-[[4-[4-cyclopropyl-1-[6-(2-hydroxyphenyl)pyridazin-4-yl]piperidine-4-carbonyl]piperazin-1-yl]methyl]piperidin-1-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 172630512 |
| Molecular Formula | C40H49N7O4 |
| Molecular Weight | 691.88 g/mol |
| Exact Mass | 691.38 |
| IUPAC Name | (3R)-3-[4-[4-[[4-[4-cyclopropyl-1-[6-(2-hydroxyphenyl)pyridazin-4-yl]piperidine-4-carbonyl]piperazin-1-yl]methyl]piperidin-1-yl]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CC[C@H](c2ccc(N3CCC(CN4CCN(C(=O)C5(C6CC6)CCN(c6cnnc(-c7ccccc7O)c6)CC5)CC4)CC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C40H49N7O4/c48-36-4-2-1-3-34(36)35-25-32(26-41-43-35)46-19-15-40(16-20-46,30-7-8-30)39(51)47-23-21-44(22-24-47)27-28-13-17-45(18-14-28)31-9-5-29(6-10-31)33-11-12-37(49)42-38(33)50/h1-6,9-10,25-26,28,30,33,48H,7-8,11-24,27H2,(H,42,49,50)/t33-/m1/s1 |
| InChIKey | VPIGEYOHXNDUPS-MGBGTMOVSA-N |
| XLogP | 4.43 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.88 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|