C45H53N7O4 — CID 172630488
N-[4-[[1-[4-[(3R)-2,6-dioxopiperidin-3-yl]phenyl]piperidin-4-yl]methylamino]cyclohexyl]-1-[6-(2-hydroxyphenyl)pyridazin-4-yl]-4-phenylpiperidine-4-carboxamide (PubChem CID 172630488) has the molecular formula C45H53N7O4 and a molecular weight of 755.96 g/mol. Its IUPAC name is N-[4-[[1-[4-[(3R)-2,6-dioxopiperidin-3-yl]phenyl]piperidin-4-yl]methylamino]cyclohexyl]-1-[6-(2-hydroxyphenyl)pyridazin-4-yl]-4-phenylpiperidine-4-carboxamide.
| Compound Name | N-[4-[[1-[4-[(3R)-2,6-dioxopiperidin-3-yl]phenyl]piperidin-4-yl]methylamino]cyclohexyl]-1-[6-(2-hydroxyphenyl)pyridazin-4-yl]-4-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 172630488 |
| Molecular Formula | C45H53N7O4 |
| Molecular Weight | 755.96 g/mol |
| Exact Mass | 755.42 |
| IUPAC Name | N-[4-[[1-[4-[(3R)-2,6-dioxopiperidin-3-yl]phenyl]piperidin-4-yl]methylamino]cyclohexyl]-1-[6-(2-hydroxyphenyl)pyridazin-4-yl]-4-phenylpiperidine-4-carboxamide |
| SMILES | O=C1CC[C@H](c2ccc(N3CCC(CNC4CCC(NC(=O)C5(c6ccccc6)CCN(c6cnnc(-c7ccccc7O)c6)CC5)CC4)CC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C45H53N7O4/c53-41-9-5-4-8-39(41)40-28-37(30-47-50-40)52-26-22-45(23-27-52,33-6-2-1-3-7-33)44(56)48-35-14-12-34(13-15-35)46-29-31-20-24-51(25-21-31)36-16-10-32(11-17-36)38-18-19-42(54)49-43(38)55/h1-11,16-17,28,30-31,34-35,38,46,53H,12-15,18-27,29H2,(H,48,56)(H,49,54,55)/t34?,35?,38-/m1/s1 |
| InChIKey | PHNAATOZMIFJIE-RHLLQQSDSA-N |
| XLogP | 5.84 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.96 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|