C30H35N5O2 — CID 172630663
3,4,4a,5,6,7,8,8a-octahydro-2H-1,5-naphthyridin-1-yl-[1-[6-(2-hydroxyphenyl)pyridazin-4-yl]-4-phenylpiperidin-4-yl]methanone (PubChem CID 172630663) has the molecular formula C30H35N5O2 and a molecular weight of 497.64 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-1,5-naphthyridin-1-yl-[1-[6-(2-hydroxyphenyl)pyridazin-4-yl]-4-phenylpiperidin-4-yl]methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-1,5-naphthyridin-1-yl-[1-[6-(2-hydroxyphenyl)pyridazin-4-yl]-4-phenylpiperidin-4-yl]methanone |
|---|---|
| PubChem CID | 172630663 |
| Molecular Formula | C30H35N5O2 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-1,5-naphthyridin-1-yl-[1-[6-(2-hydroxyphenyl)pyridazin-4-yl]-4-phenylpiperidin-4-yl]methanone |
| SMILES | O=C(N1CCCC2NCCCC21)C1(c2ccccc2)CCN(c2cnnc(-c3ccccc3O)c2)CC1 |
| InChI | InChI=1S/C30H35N5O2/c36-28-13-5-4-10-24(28)26-20-23(21-32-33-26)34-18-14-30(15-19-34,22-8-2-1-3-9-22)29(37)35-17-7-11-25-27(35)12-6-16-31-25/h1-5,8-10,13,20-21,25,27,31,36H,6-7,11-12,14-19H2 |
| InChIKey | BYUPAWLTHDHAGU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |