C16H22N2O3 — CID 107690258
(2,6-dihydroxyphenyl)-(2-pyrrolidin-2-ylpiperidin-1-yl)methanone (PubChem CID 107690258) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is (2,6-dihydroxyphenyl)-(2-pyrrolidin-2-ylpiperidin-1-yl)methanone.
| Compound Name | (2,6-dihydroxyphenyl)-(2-pyrrolidin-2-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 107690258 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | (2,6-dihydroxyphenyl)-(2-pyrrolidin-2-ylpiperidin-1-yl)methanone |
| SMILES | O=C(c1c(O)cccc1O)N1CCCCC1C1CCCN1 |
| InChI | InChI=1S/C16H22N2O3/c19-13-7-3-8-14(20)15(13)16(21)18-10-2-1-6-12(18)11-5-4-9-17-11/h3,7-8,11-12,17,19-20H,1-2,4-6,9-10H2 |
| InChIKey | LYTOGTYAMGFGJM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |