C17H24N2OS — CID 79213916
(2-methylsulfanylphenyl)-(2-pyrrolidin-2-ylpiperidin-1-yl)methanone (PubChem CID 79213916) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is (2-methylsulfanylphenyl)-(2-pyrrolidin-2-ylpiperidin-1-yl)methanone.
| Compound Name | (2-methylsulfanylphenyl)-(2-pyrrolidin-2-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 79213916 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (2-methylsulfanylphenyl)-(2-pyrrolidin-2-ylpiperidin-1-yl)methanone |
| SMILES | CSc1ccccc1C(=O)N1CCCCC1C1CCCN1 |
| InChI | InChI=1S/C17H24N2OS/c1-21-16-10-3-2-7-13(16)17(20)19-12-5-4-9-15(19)14-8-6-11-18-14/h2-3,7,10,14-15,18H,4-6,8-9,11-12H2,1H3 |
| InChIKey | TUHGEJAOZUWJGE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |