C15H20ClNOS — CID 79205658
[2-(2-chloroethyl)piperidin-1-yl]-(2-methylsulfanylphenyl)methanone (PubChem CID 79205658) has the molecular formula C15H20ClNOS and a molecular weight of 297.85 g/mol. Its IUPAC name is [2-(2-chloroethyl)piperidin-1-yl]-(2-methylsulfanylphenyl)methanone.
| Compound Name | [2-(2-chloroethyl)piperidin-1-yl]-(2-methylsulfanylphenyl)methanone |
|---|---|
| PubChem CID | 79205658 |
| Molecular Formula | C15H20ClNOS |
| Molecular Weight | 297.85 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | [2-(2-chloroethyl)piperidin-1-yl]-(2-methylsulfanylphenyl)methanone |
| SMILES | CSc1ccccc1C(=O)N1CCCCC1CCCl |
| InChI | InChI=1S/C15H20ClNOS/c1-19-14-8-3-2-7-13(14)15(18)17-11-5-4-6-12(17)9-10-16/h2-3,7-8,12H,4-6,9-11H2,1H3 |
| InChIKey | NKDPVYKKKHKXRE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.85 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|