C15H19Cl2NOS — CID 63393444
[2-(2-chloroethyl)piperidin-1-yl]-(2-chloro-5-methylsulfanylphenyl)methanone (PubChem CID 63393444) has the molecular formula C15H19Cl2NOS and a molecular weight of 332.30 g/mol. Its IUPAC name is [2-(2-chloroethyl)piperidin-1-yl]-(2-chloro-5-methylsulfanylphenyl)methanone.
| Compound Name | [2-(2-chloroethyl)piperidin-1-yl]-(2-chloro-5-methylsulfanylphenyl)methanone |
|---|---|
| PubChem CID | 63393444 |
| Molecular Formula | C15H19Cl2NOS |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | [2-(2-chloroethyl)piperidin-1-yl]-(2-chloro-5-methylsulfanylphenyl)methanone |
| SMILES | CSc1ccc(Cl)c(C(=O)N2CCCCC2CCCl)c1 |
| InChI | InChI=1S/C15H19Cl2NOS/c1-20-12-5-6-14(17)13(10-12)15(19)18-9-3-2-4-11(18)7-8-16/h5-6,10-11H,2-4,7-9H2,1H3 |
| InChIKey | XDZOXMNMXZPNRJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|