C19H20ClNO2S — CID 112766798
(2-chloro-5-methylsulfanylphenyl)-[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone (PubChem CID 112766798) has the molecular formula C19H20ClNO2S and a molecular weight of 361.89 g/mol. Its IUPAC name is (2-chloro-5-methylsulfanylphenyl)-[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone.
| Compound Name | (2-chloro-5-methylsulfanylphenyl)-[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 112766798 |
| Molecular Formula | C19H20ClNO2S |
| Molecular Weight | 361.89 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | (2-chloro-5-methylsulfanylphenyl)-[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone |
| SMILES | COc1ccc(C2CCCN2C(=O)c2cc(SC)ccc2Cl)cc1 |
| InChI | InChI=1S/C19H20ClNO2S/c1-23-14-7-5-13(6-8-14)18-4-3-11-21(18)19(22)16-12-15(24-2)9-10-17(16)20/h5-10,12,18H,3-4,11H2,1-2H3 |
| InChIKey | TZRVNMSMFOZWLM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.89 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |