C16H19ClN2O2S — CID 94061700
(2R)-1-(2-chloro-5-methylsulfanylbenzoyl)-N-cyclopropylpyrrolidine-2-carboxamide (PubChem CID 94061700) has the molecular formula C16H19ClN2O2S and a molecular weight of 338.86 g/mol. Its IUPAC name is (2R)-1-(2-chloro-5-methylsulfanylbenzoyl)-N-cyclopropylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-(2-chloro-5-methylsulfanylbenzoyl)-N-cyclopropylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 94061700 |
| Molecular Formula | C16H19ClN2O2S |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (2R)-1-(2-chloro-5-methylsulfanylbenzoyl)-N-cyclopropylpyrrolidine-2-carboxamide |
| SMILES | CSc1ccc(Cl)c(C(=O)N2CCC[C@@H]2C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C16H19ClN2O2S/c1-22-11-6-7-13(17)12(9-11)16(21)19-8-2-3-14(19)15(20)18-10-4-5-10/h6-7,9-10,14H,2-5,8H2,1H3,(H,18,20)/t14-/m1/s1 |
| InChIKey | VXTBDIIZWRJPIG-CQSZACIVSA-N |
| XLogP | 2.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |