C32H36N4O4 — CID 22492888
methyl 4-[[[4-[4-(4-phenylcyclohexyl)piperazin-1-yl]benzoyl]amino]carbamoyl]benzoate (PubChem CID 22492888) has the molecular formula C32H36N4O4 and a molecular weight of 540.66 g/mol. Its IUPAC name is methyl 4-[[[4-[4-(4-phenylcyclohexyl)piperazin-1-yl]benzoyl]amino]carbamoyl]benzoate.
| Compound Name | methyl 4-[[[4-[4-(4-phenylcyclohexyl)piperazin-1-yl]benzoyl]amino]carbamoyl]benzoate |
|---|---|
| PubChem CID | 22492888 |
| Molecular Formula | C32H36N4O4 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | methyl 4-[[[4-[4-(4-phenylcyclohexyl)piperazin-1-yl]benzoyl]amino]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)NNC(=O)c2ccc(N3CCN(C4CCC(c5ccccc5)CC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C32H36N4O4/c1-40-32(39)27-9-7-25(8-10-27)30(37)33-34-31(38)26-13-17-29(18-14-26)36-21-19-35(20-22-36)28-15-11-24(12-16-28)23-5-3-2-4-6-23/h2-10,13-14,17-18,24,28H,11-12,15-16,19-22H2,1H3,(H,33,37)(H,34,38) |
| InChIKey | FYLBNOPZXWDJNP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|