C18H25FN4O — CID 171849786
5-fluoro-2-[4-(2-methyl-2-azaspiro[3.4]octan-6-yl)piperazin-1-yl]pyridine-3-carbaldehyde (PubChem CID 171849786) has the molecular formula C18H25FN4O and a molecular weight of 332.42 g/mol. Its IUPAC name is 5-fluoro-2-[4-(2-methyl-2-azaspiro[3.4]octan-6-yl)piperazin-1-yl]pyridine-3-carbaldehyde.
| Compound Name | 5-fluoro-2-[4-(2-methyl-2-azaspiro[3.4]octan-6-yl)piperazin-1-yl]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 171849786 |
| Molecular Formula | C18H25FN4O |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 5-fluoro-2-[4-(2-methyl-2-azaspiro[3.4]octan-6-yl)piperazin-1-yl]pyridine-3-carbaldehyde |
| SMILES | CN1CC2(CCC(N3CCN(c4ncc(F)cc4C=O)CC3)C2)C1 |
| InChI | InChI=1S/C18H25FN4O/c1-21-12-18(13-21)3-2-16(9-18)22-4-6-23(7-5-22)17-14(11-24)8-15(19)10-20-17/h8,10-11,16H,2-7,9,12-13H2,1H3 |
| InChIKey | OWLAWARYFOXDBL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|