C19H27FN6 — CID 171092474
1-[5-fluoro-3-[4-(2-methyl-2-azaspiro[3.4]octan-6-yl)piperazin-1-yl]-2-pyridinyl]ethane-1,2-diimine (PubChem CID 171092474) has the molecular formula C19H27FN6 and a molecular weight of 358.47 g/mol. Its IUPAC name is 1-[5-fluoro-3-[4-(2-methyl-2-azaspiro[3.4]octan-6-yl)piperazin-1-yl]-2-pyridinyl]ethane-1,2-diimine.
| Compound Name | 1-[5-fluoro-3-[4-(2-methyl-2-azaspiro[3.4]octan-6-yl)piperazin-1-yl]-2-pyridinyl]ethane-1,2-diimine |
|---|---|
| PubChem CID | 171092474 |
| Molecular Formula | C19H27FN6 |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 1-[5-fluoro-3-[4-(2-methyl-2-azaspiro[3.4]octan-6-yl)piperazin-1-yl]-2-pyridinyl]ethane-1,2-diimine |
| SMILES | [H]/N=C(\C=N\[H])c1ncc(F)cc1N1CCN(C2CCC3(C2)CN(C)C3)CC1 |
| InChI | InChI=1S/C19H27FN6/c1-24-12-19(13-24)3-2-15(9-19)25-4-6-26(7-5-25)17-8-14(20)11-23-18(17)16(22)10-21/h8,10-11,15,21-22H,2-7,9,12-13H2,1H3/b21-10+,22-16+ |
| InChIKey | HBUDSXTUPRZNCJ-RQALOGEDSA-N |
| XLogP | 1.84 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|