C15H23N3O2 — CID 141139652
[(1S)-1-[4-(4-methyl-1,4-diazepan-1-yl)phenyl]ethyl]carbamic acid (PubChem CID 141139652) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is [(1S)-1-[4-(4-methyl-1,4-diazepan-1-yl)phenyl]ethyl]carbamic acid.
| Compound Name | [(1S)-1-[4-(4-methyl-1,4-diazepan-1-yl)phenyl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 141139652 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | [(1S)-1-[4-(4-methyl-1,4-diazepan-1-yl)phenyl]ethyl]carbamic acid |
| SMILES | C[C@H](NC(=O)O)c1ccc(N2CCCN(C)CC2)cc1 |
| InChI | InChI=1S/C15H23N3O2/c1-12(16-15(19)20)13-4-6-14(7-5-13)18-9-3-8-17(2)10-11-18/h4-7,12,16H,3,8-11H2,1-2H3,(H,19,20)/t12-/m0/s1 |
| InChIKey | GLZVJZOLVXQMLF-LBPRGKRZSA-N |
| XLogP | 2.16 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|