C19H29N3O — CID 95706399
(3R)-1-methyl-N-[(1S)-1-(4-pyrrolidin-1-ylphenyl)ethyl]piperidine-3-carboxamide (PubChem CID 95706399) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is (3R)-1-methyl-N-[(1S)-1-(4-pyrrolidin-1-ylphenyl)ethyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-methyl-N-[(1S)-1-(4-pyrrolidin-1-ylphenyl)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95706399 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | (3R)-1-methyl-N-[(1S)-1-(4-pyrrolidin-1-ylphenyl)ethyl]piperidine-3-carboxamide |
| SMILES | C[C@H](NC(=O)[C@@H]1CCCN(C)C1)c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C19H29N3O/c1-15(20-19(23)17-6-5-11-21(2)14-17)16-7-9-18(10-8-16)22-12-3-4-13-22/h7-10,15,17H,3-6,11-14H2,1-2H3,(H,20,23)/t15-,17+/m0/s1 |
| InChIKey | UPHSKEGBNUACFW-DOTOQJQBSA-N |
| XLogP | 2.81 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|