C26H35N3O3S — CID 125071514
(3S)-1-(benzenesulfonyl)-N-[(1S)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]piperidine-3-carboxamide (PubChem CID 125071514) has the molecular formula C26H35N3O3S and a molecular weight of 469.65 g/mol. Its IUPAC name is (3S)-1-(benzenesulfonyl)-N-[(1S)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-(benzenesulfonyl)-N-[(1S)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 125071514 |
| Molecular Formula | C26H35N3O3S |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | (3S)-1-(benzenesulfonyl)-N-[(1S)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]piperidine-3-carboxamide |
| SMILES | CC1CCN(c2ccc([C@H](C)NC(=O)[C@H]3CCCN(S(=O)(=O)c4ccccc4)C3)cc2)CC1 |
| InChI | InChI=1S/C26H35N3O3S/c1-20-14-17-28(18-15-20)24-12-10-22(11-13-24)21(2)27-26(30)23-7-6-16-29(19-23)33(31,32)25-8-4-3-5-9-25/h3-5,8-13,20-21,23H,6-7,14-19H2,1-2H3,(H,27,30)/t21-,23-/m0/s1 |
| InChIKey | BKJOCBUJLCGDBN-GMAHTHKFSA-N |
| XLogP | 4.20 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|