C21H33N3O — CID 99970531
(3S)-1-methyl-N-[(1S)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]piperidine-3-carboxamide (PubChem CID 99970531) has the molecular formula C21H33N3O and a molecular weight of 343.51 g/mol. Its IUPAC name is (3S)-1-methyl-N-[(1S)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-methyl-N-[(1S)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 99970531 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | (3S)-1-methyl-N-[(1S)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]piperidine-3-carboxamide |
| SMILES | CC1CCN(c2ccc([C@H](C)NC(=O)[C@H]3CCCN(C)C3)cc2)CC1 |
| InChI | InChI=1S/C21H33N3O/c1-16-10-13-24(14-11-16)20-8-6-18(7-9-20)17(2)22-21(25)19-5-4-12-23(3)15-19/h6-9,16-17,19H,4-5,10-15H2,1-3H3,(H,22,25)/t17-,19-/m0/s1 |
| InChIKey | MNYGSQGRBNXNKG-HKUYNNGSSA-N |
| XLogP | 3.44 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|