C19H30N4O2 — CID 97249594
1-[(2R,3R)-2-methyloxolan-3-yl]-3-[(1S)-1-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]urea (PubChem CID 97249594) has the molecular formula C19H30N4O2 and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-[(2R,3R)-2-methyloxolan-3-yl]-3-[(1S)-1-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]urea.
| Compound Name | 1-[(2R,3R)-2-methyloxolan-3-yl]-3-[(1S)-1-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 97249594 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 1-[(2R,3R)-2-methyloxolan-3-yl]-3-[(1S)-1-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]urea |
| SMILES | C[C@H](NC(=O)N[C@@H]1CCO[C@@H]1C)c1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C19H30N4O2/c1-14(20-19(24)21-18-8-13-25-15(18)2)16-4-6-17(7-5-16)23-11-9-22(3)10-12-23/h4-7,14-15,18H,8-13H2,1-3H3,(H2,20,21,24)/t14-,15+,18+/m0/s1 |
| InChIKey | KJVZZCVGGFGIBN-HDMKZQKVSA-N |
| XLogP | 1.98 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|